C23H21O4PSe — CID 170556133
1-ethoxy-3-(4-methoxyphenyl)-4-phenylselanyl-2,1λ5-benzoxaphosphinine 1-oxide (PubChem CID 170556133) has the molecular formula C23H21O4PSe and a molecular weight of 471.35 g/mol. Its IUPAC name is 1-ethoxy-3-(4-methoxyphenyl)-4-phenylselanyl-2,1λ5-benzoxaphosphinine 1-oxide.
| Compound Name | 1-ethoxy-3-(4-methoxyphenyl)-4-phenylselanyl-2,1λ5-benzoxaphosphinine 1-oxide |
|---|---|
| PubChem CID | 170556133 |
| Molecular Formula | C23H21O4PSe |
| Molecular Weight | 471.35 g/mol |
| Exact Mass | 472.03 |
| IUPAC Name | 1-ethoxy-3-(4-methoxyphenyl)-4-phenylselanyl-2,1λ5-benzoxaphosphinine 1-oxide |
| SMILES | CCOP1(=O)OC(c2ccc(OC)cc2)=C([Se]c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C23H21O4PSe/c1-3-26-28(24)21-12-8-7-11-20(21)23(29-19-9-5-4-6-10-19)22(27-28)17-13-15-18(25-2)16-14-17/h4-16H,3H2,1-2H3 |
| InChIKey | IRSUAGYUODFWMI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.35 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|