C10H13O3P — CID 164683795
1-ethoxy-3,4-dihydro-2,1λ5-benzoxaphosphinine 1-oxide (PubChem CID 164683795) has the molecular formula C10H13O3P and a molecular weight of 212.19 g/mol. Its IUPAC name is 1-ethoxy-3,4-dihydro-2,1λ5-benzoxaphosphinine 1-oxide.
| Compound Name | 1-ethoxy-3,4-dihydro-2,1λ5-benzoxaphosphinine 1-oxide |
|---|---|
| PubChem CID | 164683795 |
| Molecular Formula | C10H13O3P |
| Molecular Weight | 212.19 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 1-ethoxy-3,4-dihydro-2,1λ5-benzoxaphosphinine 1-oxide |
| SMILES | CCOP1(=O)OCCc2ccccc21 |
| InChI | InChI=1S/C10H13O3P/c1-2-12-14(11)10-6-4-3-5-9(10)7-8-13-14/h3-6H,2,7-8H2,1H3 |
| InChIKey | FKNUDTDMJJUTMX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.19 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|