C17H16FO3P — CID 118536975
1-ethoxy-6-fluoro-3-methyl-4-phenyl-2,1λ5-benzoxaphosphinine 1-oxide (PubChem CID 118536975) has the molecular formula C17H16FO3P and a molecular weight of 318.28 g/mol. Its IUPAC name is 1-ethoxy-6-fluoro-3-methyl-4-phenyl-2,1λ5-benzoxaphosphinine 1-oxide.
| Compound Name | 1-ethoxy-6-fluoro-3-methyl-4-phenyl-2,1λ5-benzoxaphosphinine 1-oxide |
|---|---|
| PubChem CID | 118536975 |
| Molecular Formula | C17H16FO3P |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 1-ethoxy-6-fluoro-3-methyl-4-phenyl-2,1λ5-benzoxaphosphinine 1-oxide |
| SMILES | CCOP1(=O)OC(C)=C(c2ccccc2)c2cc(F)ccc21 |
| InChI | InChI=1S/C17H16FO3P/c1-3-20-22(19)16-10-9-14(18)11-15(16)17(12(2)21-22)13-7-5-4-6-8-13/h4-11H,3H2,1-2H3 |
| InChIKey | IZPSDYVJGSBFBM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|