C16H16NO3P — CID 142733310
1-ethoxy-7-methyl-1-oxo-5-phenyl-2H-2,1λ5-benzazaphosphol-3-one (PubChem CID 142733310) has the molecular formula C16H16NO3P and a molecular weight of 301.28 g/mol. Its IUPAC name is 1-ethoxy-7-methyl-1-oxo-5-phenyl-2H-2,1λ5-benzazaphosphol-3-one.
| Compound Name | 1-ethoxy-7-methyl-1-oxo-5-phenyl-2H-2,1λ5-benzazaphosphol-3-one |
|---|---|
| PubChem CID | 142733310 |
| Molecular Formula | C16H16NO3P |
| Molecular Weight | 301.28 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 1-ethoxy-7-methyl-1-oxo-5-phenyl-2H-2,1λ5-benzazaphosphol-3-one |
| SMILES | CCOP1(=O)NC(=O)c2cc(-c3ccccc3)cc(C)c21 |
| InChI | InChI=1S/C16H16NO3P/c1-3-20-21(19)15-11(2)9-13(10-14(15)16(18)17-21)12-7-5-4-6-8-12/h4-10H,3H2,1-2H3,(H,17,18,19) |
| InChIKey | IETFQYSUMVSQAB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|