C15H17O+ — CID 15193558
2,6-diethyl-4-phenylpyrylium (PubChem CID 15193558) has the molecular formula C15H17O+ and a molecular weight of 213.30 g/mol. Its IUPAC name is 2,6-diethyl-4-phenylpyrylium.
| Compound Name | 2,6-diethyl-4-phenylpyrylium |
|---|---|
| PubChem CID | 15193558 |
| Molecular Formula | C15H17O+ |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 2,6-diethyl-4-phenylpyrylium |
| SMILES | CCc1cc(-c2ccccc2)cc(CC)[o+]1 |
| InChI | InChI=1S/C15H17O/c1-3-14-10-13(11-15(4-2)16-14)12-8-6-5-7-9-12/h5-11H,3-4H2,1-2H3/q+1 |
| InChIKey | UHQBECOAFCQILJ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|