C21H20O — CID 172831551
(2-ethyl-3,5-diphenylphenyl)methanol (PubChem CID 172831551) has the molecular formula C21H20O and a molecular weight of 288.39 g/mol. Its IUPAC name is (2-ethyl-3,5-diphenylphenyl)methanol.
| Compound Name | (2-ethyl-3,5-diphenylphenyl)methanol |
|---|---|
| PubChem CID | 172831551 |
| Molecular Formula | C21H20O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | (2-ethyl-3,5-diphenylphenyl)methanol |
| SMILES | CCc1c(CO)cc(-c2ccccc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C21H20O/c1-2-20-19(15-22)13-18(16-9-5-3-6-10-16)14-21(20)17-11-7-4-8-12-17/h3-14,22H,2,15H2,1H3 |
| InChIKey | VOSJCKKIKCSHID-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |