C22H22 — CID 59383229
2,3-diethyl-1,4-diphenylbenzene (PubChem CID 59383229) has the molecular formula C22H22 and a molecular weight of 286.42 g/mol. Its IUPAC name is 2,3-diethyl-1,4-diphenylbenzene.
| Compound Name | 2,3-diethyl-1,4-diphenylbenzene |
|---|---|
| PubChem CID | 59383229 |
| Molecular Formula | C22H22 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 2,3-diethyl-1,4-diphenylbenzene |
| SMILES | CCc1c(-c2ccccc2)ccc(-c2ccccc2)c1CC |
| InChI | InChI=1S/C22H22/c1-3-19-20(4-2)22(18-13-9-6-10-14-18)16-15-21(19)17-11-7-5-8-12-17/h5-16H,3-4H2,1-2H3 |
| InChIKey | FEPPNQVNINNPQW-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |