About 2-ethyl-3-phenylphenol;formaldehyde
2-ethyl-3-phenylphenol;formaldehyde (PubChem CID 175490561) has the molecular formula C15H16O2
and a molecular weight of 228.29 g/mol. Its IUPAC name is 2-ethyl-3-phenylphenol;formaldehyde.
Molecular Properties
| Compound Name | 2-ethyl-3-phenylphenol;formaldehyde |
| PubChem CID | 175490561 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 2-ethyl-3-phenylphenol;formaldehyde |
| SMILES | C=O.CCc1c(O)cccc1-c1ccccc1 |
| InChI | InChI=1S/C14H14O.CH2O/c1-2-12-13(9-6-10-14(12)15)11-7-4-3-5-8-11;1-2/h3-10,15H,2H2,1H3;1H2 |
| InChIKey | LTCHBXRIPHYVTB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-3-phenylphenol;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3-phenylphenol;formaldehyde?
The IUPAC name of 2-ethyl-3-phenylphenol;formaldehyde (CID 175490561) is 2-ethyl-3-phenylphenol;formaldehyde.
What is the SMILES notation for 2-ethyl-3-phenylphenol;formaldehyde?
The canonical SMILES for 2-ethyl-3-phenylphenol;formaldehyde is C=O.CCc1c(O)cccc1-c1ccccc1.
What is the InChIKey of 2-ethyl-3-phenylphenol;formaldehyde?
The InChIKey is LTCHBXRIPHYVTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O.CH2O/c1-2-12-13(9-6-10-14(12)15)11-7-4-3-5-8-11;1-2/h3-10,15H,2H2,1H3;1H2.
What are the key properties of 2-ethyl-3-phenylphenol;formaldehyde?
2-ethyl-3-phenylphenol;formaldehyde has a molecular weight of 228.29 g/mol, XLogP of 3.44, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3-phenylphenol;formaldehyde is sourced from PubChem (CID 175490561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).