C72H60O6 — CID 102444686
2-[4-[[3,5-bis[[4-(2-carboxy-3-phenylphenyl)phenyl]methyl]-2,4,6-triethylphenyl]methyl]phenyl]-6-phenylbenzoic acid (PubChem CID 102444686) has the molecular formula C72H60O6 and a molecular weight of 1021.27 g/mol. Its IUPAC name is 2-[4-[[3,5-bis[[4-(2-carboxy-3-phenylphenyl)phenyl]methyl]-2,4,6-triethylphenyl]methyl]phenyl]-6-phenylbenzoic acid.
| Compound Name | 2-[4-[[3,5-bis[[4-(2-carboxy-3-phenylphenyl)phenyl]methyl]-2,4,6-triethylphenyl]methyl]phenyl]-6-phenylbenzoic acid |
|---|---|
| PubChem CID | 102444686 |
| Molecular Formula | C72H60O6 |
| Molecular Weight | 1021.27 g/mol |
| Exact Mass | 1020.44 |
| IUPAC Name | 2-[4-[[3,5-bis[[4-(2-carboxy-3-phenylphenyl)phenyl]methyl]-2,4,6-triethylphenyl]methyl]phenyl]-6-phenylbenzoic acid |
| SMILES | CCc1c(Cc2ccc(-c3cccc(-c4ccccc4)c3C(=O)O)cc2)c(CC)c(Cc2ccc(-c3cccc(-c4ccccc4)c3C(=O)O)cc2)c(CC)c1Cc1ccc(-c2cccc(-c3ccccc3)c2C(=O)O)cc1 |
| InChI | InChI=1S/C72H60O6/c1-4-55-64(43-46-31-37-52(38-32-46)61-28-16-25-58(67(61)70(73)74)49-19-10-7-11-20-49)56(5-2)66(45-48-35-41-54(42-36-48)63-30-18-27-60(69(63)72(77)78)51-23-14-9-15-24-51)57(6-3)65(55)44-47-33-39-53(40-34-47)62-29-17-26-59(68(62)71(75)76)50-21-12-8-13-22-50/h7-42H,4-6,43-45H2,1-3H3,(H,73,74)(H,75,76)(H,77,78) |
| InChIKey | VTVUZRVJFWBUSA-UHFFFAOYSA-N |
| XLogP | 17.24 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1021.27 |
| LogP ≤ 5 | 17.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |