C19H18O4 — CID 174593053
benzene-1,3-diol;formaldehyde;2-phenylphenol (PubChem CID 174593053) has the molecular formula C19H18O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is benzene-1,3-diol;formaldehyde;2-phenylphenol.
| Compound Name | benzene-1,3-diol;formaldehyde;2-phenylphenol |
|---|---|
| PubChem CID | 174593053 |
| Molecular Formula | C19H18O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | benzene-1,3-diol;formaldehyde;2-phenylphenol |
| SMILES | C=O.Oc1cccc(O)c1.Oc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C12H10O.C6H6O2.CH2O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;7-5-2-1-3-6(8)4-5;1-2/h1-9,13H;1-4,7-8H;1H2 |
| InChIKey | JOOPISBFSVNTNU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |