About sodium;hydride;2-phenylphenol;4-phenylphenol
sodium;hydride;2-phenylphenol;4-phenylphenol (PubChem CID 173165495) has the molecular formula C24H21NaO2
and a molecular weight of 364.42 g/mol. Its IUPAC name is sodium;hydride;2-phenylphenol;4-phenylphenol.
Molecular Properties
| Compound Name | sodium;hydride;2-phenylphenol;4-phenylphenol |
| PubChem CID | 173165495 |
| Molecular Formula | C24H21NaO2 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | sodium;hydride;2-phenylphenol;4-phenylphenol |
| SMILES | Oc1ccc(-c2ccccc2)cc1.Oc1ccccc1-c1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/2C12H10O.Na.H/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;;/h2*1-9,13H;;/q;;+1;-1 |
| InChIKey | JTUQVCCSLPOBHV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium;hydride;2-phenylphenol;4-phenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;2-phenylphenol;4-phenylphenol?
The IUPAC name of sodium;hydride;2-phenylphenol;4-phenylphenol (CID 173165495) is sodium;hydride;2-phenylphenol;4-phenylphenol.
What is the SMILES notation for sodium;hydride;2-phenylphenol;4-phenylphenol?
The canonical SMILES for sodium;hydride;2-phenylphenol;4-phenylphenol is Oc1ccc(-c2ccccc2)cc1.Oc1ccccc1-c1ccccc1.[H-].[Na+].
What is the InChIKey of sodium;hydride;2-phenylphenol;4-phenylphenol?
The InChIKey is JTUQVCCSLPOBHV-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H10O.Na.H/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;;/h2*1-9,13H;;/q;;+1;-1.
What are the key properties of sodium;hydride;2-phenylphenol;4-phenylphenol?
sodium;hydride;2-phenylphenol;4-phenylphenol has a molecular weight of 364.42 g/mol, XLogP of 3.23, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;2-phenylphenol;4-phenylphenol is sourced from PubChem (CID 173165495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).