C12H10O2P2S4+2 — CID 175025550
2,4-bis(sulfanylidene)-1,3,2,4-dithiadiphosphetane-2,4-diium;2-(4-hydroxyphenyl)phenol (PubChem CID 175025550) has the molecular formula C12H10O2P2S4+2 and a molecular weight of 376.43 g/mol. Its IUPAC name is 2,4-bis(sulfanylidene)-1,3,2,4-dithiadiphosphetane-2,4-diium;2-(4-hydroxyphenyl)phenol.
| Compound Name | 2,4-bis(sulfanylidene)-1,3,2,4-dithiadiphosphetane-2,4-diium;2-(4-hydroxyphenyl)phenol |
|---|---|
| PubChem CID | 175025550 |
| Molecular Formula | C12H10O2P2S4+2 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 375.90 |
| IUPAC Name | 2,4-bis(sulfanylidene)-1,3,2,4-dithiadiphosphetane-2,4-diium;2-(4-hydroxyphenyl)phenol |
| SMILES | Oc1ccc(-c2ccccc2O)cc1.S=[P+]1S[P+](=S)S1 |
| InChI | InChI=1S/C12H10O2.P2S4/c13-10-7-5-9(6-8-10)11-3-1-2-4-12(11)14;3-1-5-2(4)6-1/h1-8,13-14H;/q;+2 |
| InChIKey | LNDPRKZNENZITP-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|