C34H38O3P+ — CID 66871039
bis[(2,3-diethyl-4-phenylphenyl)methoxy]-oxophosphanium (PubChem CID 66871039) has the molecular formula C34H38O3P+ and a molecular weight of 525.65 g/mol. Its IUPAC name is bis[(2,3-diethyl-4-phenylphenyl)methoxy]-oxophosphanium.
| Compound Name | bis[(2,3-diethyl-4-phenylphenyl)methoxy]-oxophosphanium |
|---|---|
| PubChem CID | 66871039 |
| Molecular Formula | C34H38O3P+ |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | bis[(2,3-diethyl-4-phenylphenyl)methoxy]-oxophosphanium |
| SMILES | CCc1c(CO[P+](=O)OCc2ccc(-c3ccccc3)c(CC)c2CC)ccc(-c2ccccc2)c1CC |
| InChI | InChI=1S/C34H38O3P/c1-5-29-27(19-21-33(31(29)7-3)25-15-11-9-12-16-25)23-36-38(35)37-24-28-20-22-34(26-17-13-10-14-18-26)32(8-4)30(28)6-2/h9-22H,5-8,23-24H2,1-4H3/q+1 |
| InChIKey | DVSZWDBCXWEHBC-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|