C32H34S4 — CID 88639395
4-[(2,6-diethyl-3-phenylphenyl)disulfanyl]-3,5-diethyl-6-phenylbenzene-1,2-dithiol (PubChem CID 88639395) has the molecular formula C32H34S4 and a molecular weight of 546.89 g/mol. Its IUPAC name is 4-[(2,6-diethyl-3-phenylphenyl)disulfanyl]-3,5-diethyl-6-phenylbenzene-1,2-dithiol.
| Compound Name | 4-[(2,6-diethyl-3-phenylphenyl)disulfanyl]-3,5-diethyl-6-phenylbenzene-1,2-dithiol |
|---|---|
| PubChem CID | 88639395 |
| Molecular Formula | C32H34S4 |
| Molecular Weight | 546.89 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | 4-[(2,6-diethyl-3-phenylphenyl)disulfanyl]-3,5-diethyl-6-phenylbenzene-1,2-dithiol |
| SMILES | CCc1ccc(-c2ccccc2)c(CC)c1SSc1c(CC)c(S)c(S)c(-c2ccccc2)c1CC |
| InChI | InChI=1S/C32H34S4/c1-5-21-19-20-27(22-15-11-9-12-16-22)24(6-2)31(21)35-36-32-25(7-3)28(23-17-13-10-14-18-23)30(34)29(33)26(32)8-4/h9-20,33-34H,5-8H2,1-4H3 |
| InChIKey | NIPHDXLUWLFWCE-UHFFFAOYSA-N |
| XLogP | 10.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.89 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|