C17H20S — CID 140644848
2-ethyl-3,4,5-trimethyl-6-phenylbenzenethiol (PubChem CID 140644848) has the molecular formula C17H20S and a molecular weight of 256.41 g/mol. Its IUPAC name is 2-ethyl-3,4,5-trimethyl-6-phenylbenzenethiol.
| Compound Name | 2-ethyl-3,4,5-trimethyl-6-phenylbenzenethiol |
|---|---|
| PubChem CID | 140644848 |
| Molecular Formula | C17H20S |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 2-ethyl-3,4,5-trimethyl-6-phenylbenzenethiol |
| SMILES | CCc1c(C)c(C)c(C)c(-c2ccccc2)c1S |
| InChI | InChI=1S/C17H20S/c1-5-15-12(3)11(2)13(4)16(17(15)18)14-9-7-6-8-10-14/h6-10,18H,5H2,1-4H3 |
| InChIKey | NHCAVZMGWRTAEV-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|