C19H21NO — CID 22086858
8-ethyl-3,6,7-trimethyl-2-phenyl-1H-indolizin-5-one (PubChem CID 22086858) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is 8-ethyl-3,6,7-trimethyl-2-phenyl-1H-indolizin-5-one.
| Compound Name | 8-ethyl-3,6,7-trimethyl-2-phenyl-1H-indolizin-5-one |
|---|---|
| PubChem CID | 22086858 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 8-ethyl-3,6,7-trimethyl-2-phenyl-1H-indolizin-5-one |
| SMILES | CCc1c(C)c(C)c(=O)n2c1CC(c1ccccc1)=C2C |
| InChI | InChI=1S/C19H21NO/c1-5-16-12(2)13(3)19(21)20-14(4)17(11-18(16)20)15-9-7-6-8-10-15/h6-10H,5,11H2,1-4H3 |
| InChIKey | TUPKJZWSLYQBOF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |