C24H21N2O2+ — CID 1037172
5-ethyl-6-hydroxy-1,2,3-triphenylpyrimidin-1-ium-4-one (PubChem CID 1037172) has the molecular formula C24H21N2O2+ and a molecular weight of 369.44 g/mol. Its IUPAC name is 5-ethyl-6-hydroxy-1,2,3-triphenylpyrimidin-1-ium-4-one.
| Compound Name | 5-ethyl-6-hydroxy-1,2,3-triphenylpyrimidin-1-ium-4-one |
|---|---|
| PubChem CID | 1037172 |
| Molecular Formula | C24H21N2O2+ |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 5-ethyl-6-hydroxy-1,2,3-triphenylpyrimidin-1-ium-4-one |
| SMILES | CCc1c(O)[n+](-c2ccccc2)c(-c2ccccc2)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C24H20N2O2/c1-2-21-23(27)25(19-14-8-4-9-15-19)22(18-12-6-3-7-13-18)26(24(21)28)20-16-10-5-11-17-20/h3-17H,2H2,1H3/p+1 |
| InChIKey | CHBYIYOKTJYFPG-UHFFFAOYSA-O |
| XLogP | 4.05 |
| TPSA | 46.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|