C25H21N2O2+ — CID 110272969
2-benzyl-1-hydroxy-4-phenyl-5,6-dihydropyrimido[1,2-a]quinolin-11-ium-3-one (PubChem CID 110272969) has the molecular formula C25H21N2O2+ and a molecular weight of 381.46 g/mol. Its IUPAC name is 2-benzyl-1-hydroxy-4-phenyl-5,6-dihydropyrimido[1,2-a]quinolin-11-ium-3-one.
| Compound Name | 2-benzyl-1-hydroxy-4-phenyl-5,6-dihydropyrimido[1,2-a]quinolin-11-ium-3-one |
|---|---|
| PubChem CID | 110272969 |
| Molecular Formula | C25H21N2O2+ |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 2-benzyl-1-hydroxy-4-phenyl-5,6-dihydropyrimido[1,2-a]quinolin-11-ium-3-one |
| SMILES | O=c1c(Cc2ccccc2)c(O)[n+]2c(n1-c1ccccc1)CCc1ccccc1-2 |
| InChI | InChI=1S/C25H20N2O2/c28-24-21(17-18-9-3-1-4-10-18)25(29)27-22-14-8-7-11-19(22)15-16-23(27)26(24)20-12-5-2-6-13-20/h1-14H,15-17H2/p+1 |
| InChIKey | QJRRDXRKDSBVAW-UHFFFAOYSA-O |
| XLogP | 3.51 |
| TPSA | 46.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|