C28H22N2O3 — CID 123545313
1-benzyl-6-hydroxy-5-(naphthalen-2-ylmethyl)-3-phenylpyrimidine-2,4-dione (PubChem CID 123545313) has the molecular formula C28H22N2O3 and a molecular weight of 434.50 g/mol. Its IUPAC name is 1-benzyl-6-hydroxy-5-(naphthalen-2-ylmethyl)-3-phenylpyrimidine-2,4-dione.
| Compound Name | 1-benzyl-6-hydroxy-5-(naphthalen-2-ylmethyl)-3-phenylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 123545313 |
| Molecular Formula | C28H22N2O3 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 1-benzyl-6-hydroxy-5-(naphthalen-2-ylmethyl)-3-phenylpyrimidine-2,4-dione |
| SMILES | O=c1c(Cc2ccc3ccccc3c2)c(O)n(Cc2ccccc2)c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C28H22N2O3/c31-26-25(18-21-15-16-22-11-7-8-12-23(22)17-21)27(32)30(24-13-5-2-6-14-24)28(33)29(26)19-20-9-3-1-4-10-20/h1-17,31H,18-19H2 |
| InChIKey | JRQGZRGXCATQDH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 64.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |