C32H26N4O2S — CID 12946548
1,7-dibenzyl-8-benzylsulfanyl-3-phenylpurine-2,6-dione (PubChem CID 12946548) has the molecular formula C32H26N4O2S and a molecular weight of 530.65 g/mol. Its IUPAC name is 1,7-dibenzyl-8-benzylsulfanyl-3-phenylpurine-2,6-dione.
| Compound Name | 1,7-dibenzyl-8-benzylsulfanyl-3-phenylpurine-2,6-dione |
|---|---|
| PubChem CID | 12946548 |
| Molecular Formula | C32H26N4O2S |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | 1,7-dibenzyl-8-benzylsulfanyl-3-phenylpurine-2,6-dione |
| SMILES | O=c1c2c(nc(SCc3ccccc3)n2Cc2ccccc2)n(-c2ccccc2)c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C32H26N4O2S/c37-30-28-29(36(27-19-11-4-12-20-27)32(38)35(30)22-25-15-7-2-8-16-25)33-31(39-23-26-17-9-3-10-18-26)34(28)21-24-13-5-1-6-14-24/h1-20H,21-23H2 |
| InChIKey | GGPXZTALYBUXGD-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |