C17H18N4O2S — CID 788427
8-benzylsulfanyl-1,3-dimethyl-7-prop-2-enylpurine-2,6-dione (PubChem CID 788427) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is 8-benzylsulfanyl-1,3-dimethyl-7-prop-2-enylpurine-2,6-dione.
| Compound Name | 8-benzylsulfanyl-1,3-dimethyl-7-prop-2-enylpurine-2,6-dione |
|---|---|
| PubChem CID | 788427 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 8-benzylsulfanyl-1,3-dimethyl-7-prop-2-enylpurine-2,6-dione |
| SMILES | C=CCn1c(SCc2ccccc2)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C17H18N4O2S/c1-4-10-21-13-14(19(2)17(23)20(3)15(13)22)18-16(21)24-11-12-8-6-5-7-9-12/h4-9H,1,10-11H2,2-3H3 |
| InChIKey | VYYUXIMLGZAHCA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|