C14H20N4O2S — CID 788425
8-[(2S)-butan-2-yl]sulfanyl-1,3-dimethyl-7-prop-2-enylpurine-2,6-dione (PubChem CID 788425) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is 8-[(2S)-butan-2-yl]sulfanyl-1,3-dimethyl-7-prop-2-enylpurine-2,6-dione.
| Compound Name | 8-[(2S)-butan-2-yl]sulfanyl-1,3-dimethyl-7-prop-2-enylpurine-2,6-dione |
|---|---|
| PubChem CID | 788425 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 8-[(2S)-butan-2-yl]sulfanyl-1,3-dimethyl-7-prop-2-enylpurine-2,6-dione |
| SMILES | C=CCn1c(S[C@@H](C)CC)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C14H20N4O2S/c1-6-8-18-10-11(15-13(18)21-9(3)7-2)16(4)14(20)17(5)12(10)19/h6,9H,1,7-8H2,2-5H3/t9-/m0/s1 |
| InChIKey | PUKZAEKDKXQKFO-VIFPVBQESA-N |
| XLogP | 1.51 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|