C16H21N5O2 — CID 16812080
7-tert-butyl-2,4-dimethyl-6-prop-2-enylpurino[7,8-a]imidazole-1,3-dione (PubChem CID 16812080) has the molecular formula C16H21N5O2 and a molecular weight of 315.38 g/mol. Its IUPAC name is 7-tert-butyl-2,4-dimethyl-6-prop-2-enylpurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 7-tert-butyl-2,4-dimethyl-6-prop-2-enylpurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 16812080 |
| Molecular Formula | C16H21N5O2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 7-tert-butyl-2,4-dimethyl-6-prop-2-enylpurino[7,8-a]imidazole-1,3-dione |
| SMILES | C=CCn1c(C(C)(C)C)cn2c3c(=O)n(C)c(=O)n(C)c3nc12 |
| InChI | InChI=1S/C16H21N5O2/c1-7-8-20-10(16(2,3)4)9-21-11-12(17-14(20)21)18(5)15(23)19(6)13(11)22/h7,9H,1,8H2,2-6H3 |
| InChIKey | UDYPAYYKQOLTMA-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 66.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|