C20H18ClN5O3 — CID 7520727
2-[2-(4-chlorophenyl)-2-oxoethyl]-4,7-dimethyl-6-prop-2-enylpurino[7,8-a]imidazole-1,3-dione (PubChem CID 7520727) has the molecular formula C20H18ClN5O3 and a molecular weight of 411.85 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-2-oxoethyl]-4,7-dimethyl-6-prop-2-enylpurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 2-[2-(4-chlorophenyl)-2-oxoethyl]-4,7-dimethyl-6-prop-2-enylpurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 7520727 |
| Molecular Formula | C20H18ClN5O3 |
| Molecular Weight | 411.85 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-2-oxoethyl]-4,7-dimethyl-6-prop-2-enylpurino[7,8-a]imidazole-1,3-dione |
| SMILES | C=CCn1c(C)cn2c3c(=O)n(CC(=O)c4ccc(Cl)cc4)c(=O)n(C)c3nc12 |
| InChI | InChI=1S/C20H18ClN5O3/c1-4-9-24-12(2)10-25-16-17(22-19(24)25)23(3)20(29)26(18(16)28)11-15(27)13-5-7-14(21)8-6-13/h4-8,10H,1,9,11H2,2-3H3 |
| InChIKey | ORTDAVUYCLEGOZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 83.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.85 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|