C23H25N5O3 — CID 6492610
6-cyclohexyl-4,7-dimethyl-2-phenacylpurino[7,8-a]imidazole-1,3-dione (PubChem CID 6492610) has the molecular formula C23H25N5O3 and a molecular weight of 419.49 g/mol. Its IUPAC name is 6-cyclohexyl-4,7-dimethyl-2-phenacylpurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 6-cyclohexyl-4,7-dimethyl-2-phenacylpurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 6492610 |
| Molecular Formula | C23H25N5O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 6-cyclohexyl-4,7-dimethyl-2-phenacylpurino[7,8-a]imidazole-1,3-dione |
| SMILES | Cc1cn2c3c(=O)n(CC(=O)c4ccccc4)c(=O)n(C)c3nc2n1C1CCCCC1 |
| InChI | InChI=1S/C23H25N5O3/c1-15-13-26-19-20(24-22(26)28(15)17-11-7-4-8-12-17)25(2)23(31)27(21(19)30)14-18(29)16-9-5-3-6-10-16/h3,5-6,9-10,13,17H,4,7-8,11-12,14H2,1-2H3 |
| InChIKey | KBBAACYPLPKYHL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 83.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |