C17H21N5O2 — CID 6485051
4,7-dimethyl-2,6-bis(2-methylprop-2-enyl)purino[7,8-a]imidazole-1,3-dione (PubChem CID 6485051) has the molecular formula C17H21N5O2 and a molecular weight of 327.39 g/mol. Its IUPAC name is 4,7-dimethyl-2,6-bis(2-methylprop-2-enyl)purino[7,8-a]imidazole-1,3-dione.
| Compound Name | 4,7-dimethyl-2,6-bis(2-methylprop-2-enyl)purino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 6485051 |
| Molecular Formula | C17H21N5O2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 4,7-dimethyl-2,6-bis(2-methylprop-2-enyl)purino[7,8-a]imidazole-1,3-dione |
| SMILES | C=C(C)Cn1c(=O)c2c(nc3n(CC(=C)C)c(C)cn23)n(C)c1=O |
| InChI | InChI=1S/C17H21N5O2/c1-10(2)7-20-12(5)9-21-13-14(18-16(20)21)19(6)17(24)22(15(13)23)8-11(3)4/h9H,1,3,7-8H2,2,4-6H3 |
| InChIKey | OXQSVGIFDPZTSC-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 66.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|