C19H27N5O2 — CID 16610290
6-hexyl-4,7-dimethyl-2-(2-methylprop-2-enyl)purino[7,8-a]imidazole-1,3-dione (PubChem CID 16610290) has the molecular formula C19H27N5O2 and a molecular weight of 357.46 g/mol. Its IUPAC name is 6-hexyl-4,7-dimethyl-2-(2-methylprop-2-enyl)purino[7,8-a]imidazole-1,3-dione.
| Compound Name | 6-hexyl-4,7-dimethyl-2-(2-methylprop-2-enyl)purino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 16610290 |
| Molecular Formula | C19H27N5O2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | 6-hexyl-4,7-dimethyl-2-(2-methylprop-2-enyl)purino[7,8-a]imidazole-1,3-dione |
| SMILES | C=C(C)Cn1c(=O)c2c(nc3n(CCCCCC)c(C)cn23)n(C)c1=O |
| InChI | InChI=1S/C19H27N5O2/c1-6-7-8-9-10-22-14(4)12-23-15-16(20-18(22)23)21(5)19(26)24(17(15)25)11-13(2)3/h12H,2,6-11H2,1,3-5H3 |
| InChIKey | MMXGEZWGNDBPDS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 66.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|