C16H19N2O2+ — CID 2786378
3-ethyl-4-hydroxy-1-phenyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-5-ium-2-one (PubChem CID 2786378) has the molecular formula C16H19N2O2+ and a molecular weight of 271.34 g/mol. Its IUPAC name is 3-ethyl-4-hydroxy-1-phenyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-5-ium-2-one.
| Compound Name | 3-ethyl-4-hydroxy-1-phenyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-5-ium-2-one |
|---|---|
| PubChem CID | 2786378 |
| Molecular Formula | C16H19N2O2+ |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 3-ethyl-4-hydroxy-1-phenyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-5-ium-2-one |
| SMILES | CCc1c(O)[n+]2c(n(-c3ccccc3)c1=O)CCCC2 |
| InChI | InChI=1S/C16H18N2O2/c1-2-13-15(19)17-11-7-6-10-14(17)18(16(13)20)12-8-4-3-5-9-12/h3-5,8-9H,2,6-7,10-11H2,1H3/p+1 |
| InChIKey | AFLOYKDSCQRVNL-UHFFFAOYSA-O |
| XLogP | 1.73 |
| TPSA | 46.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|