C14H15BrN2O2 — CID 142079218
5-bromo-1,6-diethyl-3-phenylpyrimidine-2,4-dione (PubChem CID 142079218) has the molecular formula C14H15BrN2O2 and a molecular weight of 323.19 g/mol. Its IUPAC name is 5-bromo-1,6-diethyl-3-phenylpyrimidine-2,4-dione.
| Compound Name | 5-bromo-1,6-diethyl-3-phenylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 142079218 |
| Molecular Formula | C14H15BrN2O2 |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 5-bromo-1,6-diethyl-3-phenylpyrimidine-2,4-dione |
| SMILES | CCc1c(Br)c(=O)n(-c2ccccc2)c(=O)n1CC |
| InChI | InChI=1S/C14H15BrN2O2/c1-3-11-12(15)13(18)17(14(19)16(11)4-2)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 |
| InChIKey | PPMZCRNXJWJWPV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |