C25H21N4O2+ — CID 135623024
ethyl 3-imino-2-(1,4,5-triphenyl-1,2,4-triazol-4-ium-3-yl)prop-2-enoate (PubChem CID 135623024) has the molecular formula C25H21N4O2+ and a molecular weight of 409.47 g/mol. Its IUPAC name is ethyl 3-imino-2-(1,4,5-triphenyl-1,2,4-triazol-4-ium-3-yl)prop-2-enoate.
| Compound Name | ethyl 3-imino-2-(1,4,5-triphenyl-1,2,4-triazol-4-ium-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 135623024 |
| Molecular Formula | C25H21N4O2+ |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | ethyl 3-imino-2-(1,4,5-triphenyl-1,2,4-triazol-4-ium-3-yl)prop-2-enoate |
| SMILES | CCOC(=O)C(=C=N)c1nn(-c2ccccc2)c(-c2ccccc2)[n+]1-c1ccccc1 |
| InChI | InChI=1S/C25H21N4O2/c1-2-31-25(30)22(18-26)23-27-29(21-16-10-5-11-17-21)24(19-12-6-3-7-13-19)28(23)20-14-8-4-9-15-20/h3-17,26H,2H2,1H3/q+1 |
| InChIKey | RUPMGTZKWFHBBL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 71.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|