ethyl 5-acetyl-1,4-diphenylpyrazole-3-carboxylate

C20H18N2O3 — CID 100975890

IUPACethyl 5-acetyl-1,4-diphenylpyrazole-3-carboxylate
SMILESCCOC(=O)c1nn(-c2ccccc2)c(C(C)=O)c1-c1ccccc1
InChIInChI=1S/C20H18N2O3/c1-3-25-20(24)18-17(15-10-6-4-7-11-15)19(14(2)23)22(21-18)16-12-8-5-9-13-16/h4-13H,3H2,1-2H3
InChIKeyIIOKHHDSKVGYFY-UHFFFAOYSA-N
MW334.38 g/mol
LogP3.92
Rot. Bonds5

About ethyl 5-acetyl-1,4-diphenylpyrazole-3-carboxylate

ethyl 5-acetyl-1,4-diphenylpyrazole-3-carboxylate (PubChem CID 100975890) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is ethyl 5-acetyl-1,4-diphenylpyrazole-3-carboxylate.

Molecular Properties

Compound Nameethyl 5-acetyl-1,4-diphenylpyrazole-3-carboxylate
PubChem CID100975890
Molecular FormulaC20H18N2O3
Molecular Weight334.38 g/mol
Exact Mass334.13
IUPAC Nameethyl 5-acetyl-1,4-diphenylpyrazole-3-carboxylate
SMILESCCOC(=O)c1nn(-c2ccccc2)c(C(C)=O)c1-c1ccccc1
InChIInChI=1S/C20H18N2O3/c1-3-25-20(24)18-17(15-10-6-4-7-11-15)19(14(2)23)22(21-18)16-12-8-5-9-13-16/h4-13H,3H2,1-2H3
InChIKeyIIOKHHDSKVGYFY-UHFFFAOYSA-N
XLogP3.92
TPSA61.19 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms25
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500334.38
LogP ≤ 53.92
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze ethyl 5-acetyl-1,4-diphenylpyrazole-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 5-acetyl-1,4-diphenylpyrazole-3-carboxylate?
The IUPAC name of ethyl 5-acetyl-1,4-diphenylpyrazole-3-carboxylate (CID 100975890) is ethyl 5-acetyl-1,4-diphenylpyrazole-3-carboxylate.
What is the SMILES notation for ethyl 5-acetyl-1,4-diphenylpyrazole-3-carboxylate?
The canonical SMILES for ethyl 5-acetyl-1,4-diphenylpyrazole-3-carboxylate is CCOC(=O)c1nn(-c2ccccc2)c(C(C)=O)c1-c1ccccc1.
What is the InChIKey of ethyl 5-acetyl-1,4-diphenylpyrazole-3-carboxylate?
The InChIKey is IIOKHHDSKVGYFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2O3/c1-3-25-20(24)18-17(15-10-6-4-7-11-15)19(14(2)23)22(21-18)16-12-8-5-9-13-16/h4-13H,3H2,1-2H3.
What are the key properties of ethyl 5-acetyl-1,4-diphenylpyrazole-3-carboxylate?
ethyl 5-acetyl-1,4-diphenylpyrazole-3-carboxylate has a molecular weight of 334.38 g/mol, XLogP of 3.92, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-acetyl-1,4-diphenylpyrazole-3-carboxylate is sourced from PubChem (CID 100975890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).