C19H25N3O4 — CID 135063688
diethyl 5-(tert-butylamino)-1-phenylpyrazole-3,4-dicarboxylate (PubChem CID 135063688) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is diethyl 5-(tert-butylamino)-1-phenylpyrazole-3,4-dicarboxylate.
| Compound Name | diethyl 5-(tert-butylamino)-1-phenylpyrazole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 135063688 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | diethyl 5-(tert-butylamino)-1-phenylpyrazole-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccccc2)c(NC(C)(C)C)c1C(=O)OCC |
| InChI | InChI=1S/C19H25N3O4/c1-6-25-17(23)14-15(18(24)26-7-2)21-22(13-11-9-8-10-12-13)16(14)20-19(3,4)5/h8-12,20H,6-7H2,1-5H3 |
| InChIKey | HINLCKDFWGBMGK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |