C17H13F7N2O3 — CID 134910091
ethyl 3-acetyl-5-(1,1,2,2,3,3,3-heptafluoropropyl)-1-phenylpyrazole-4-carboxylate (PubChem CID 134910091) has the molecular formula C17H13F7N2O3 and a molecular weight of 426.29 g/mol. Its IUPAC name is ethyl 3-acetyl-5-(1,1,2,2,3,3,3-heptafluoropropyl)-1-phenylpyrazole-4-carboxylate.
| Compound Name | ethyl 3-acetyl-5-(1,1,2,2,3,3,3-heptafluoropropyl)-1-phenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 134910091 |
| Molecular Formula | C17H13F7N2O3 |
| Molecular Weight | 426.29 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | ethyl 3-acetyl-5-(1,1,2,2,3,3,3-heptafluoropropyl)-1-phenylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(C(C)=O)nn(-c2ccccc2)c1C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H13F7N2O3/c1-3-29-14(28)11-12(9(2)27)25-26(10-7-5-4-6-8-10)13(11)15(18,19)16(20,21)17(22,23)24/h4-8H,3H2,1-2H3 |
| InChIKey | BTAWLILIOLXVAI-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.29 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|