C14H18N3O2+ — CID 23269832
ethyl 2-(3,5-dimethyl-1-phenyl-1,2,4-triazol-4-ium-4-yl)acetate (PubChem CID 23269832) has the molecular formula C14H18N3O2+ and a molecular weight of 260.32 g/mol. Its IUPAC name is ethyl 2-(3,5-dimethyl-1-phenyl-1,2,4-triazol-4-ium-4-yl)acetate.
| Compound Name | ethyl 2-(3,5-dimethyl-1-phenyl-1,2,4-triazol-4-ium-4-yl)acetate |
|---|---|
| PubChem CID | 23269832 |
| Molecular Formula | C14H18N3O2+ |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | ethyl 2-(3,5-dimethyl-1-phenyl-1,2,4-triazol-4-ium-4-yl)acetate |
| SMILES | CCOC(=O)C[n+]1c(C)nn(-c2ccccc2)c1C |
| InChI | InChI=1S/C14H18N3O2/c1-4-19-14(18)10-16-11(2)15-17(12(16)3)13-8-6-5-7-9-13/h5-9H,4,10H2,1-3H3/q+1 |
| InChIKey | PPOOTUWMTUMIHD-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|