C12H15N3S — CID 15765967
5-methyl-1-phenyl-4-propyl-1,2,4-triazol-4-ium-3-thiolate (PubChem CID 15765967) has the molecular formula C12H15N3S and a molecular weight of 233.34 g/mol. Its IUPAC name is 5-methyl-1-phenyl-4-propyl-1,2,4-triazol-4-ium-3-thiolate.
| Compound Name | 5-methyl-1-phenyl-4-propyl-1,2,4-triazol-4-ium-3-thiolate |
|---|---|
| PubChem CID | 15765967 |
| Molecular Formula | C12H15N3S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 5-methyl-1-phenyl-4-propyl-1,2,4-triazol-4-ium-3-thiolate |
| SMILES | CCC[n+]1c([S-])nn(-c2ccccc2)c1C |
| InChI | InChI=1S/C12H15N3S/c1-3-9-14-10(2)15(13-12(14)16)11-7-5-4-6-8-11/h4-8H,3,9H2,1-2H3 |
| InChIKey | ASRVOWXWJVVUTN-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|