C18H20BrN2+ — CID 90873275
8-bromo-3-ethyl-2-phenyl-1-propylimidazo[1,2-a]pyridin-1-ium (PubChem CID 90873275) has the molecular formula C18H20BrN2+ and a molecular weight of 344.28 g/mol. Its IUPAC name is 8-bromo-3-ethyl-2-phenyl-1-propylimidazo[1,2-a]pyridin-1-ium.
| Compound Name | 8-bromo-3-ethyl-2-phenyl-1-propylimidazo[1,2-a]pyridin-1-ium |
|---|---|
| PubChem CID | 90873275 |
| Molecular Formula | C18H20BrN2+ |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 8-bromo-3-ethyl-2-phenyl-1-propylimidazo[1,2-a]pyridin-1-ium |
| SMILES | CCC[n+]1c(-c2ccccc2)c(CC)n2cccc(Br)c21 |
| InChI | InChI=1S/C18H20BrN2/c1-3-12-21-17(14-9-6-5-7-10-14)16(4-2)20-13-8-11-15(19)18(20)21/h5-11,13H,3-4,12H2,1-2H3/q+1 |
| InChIKey | WNNIYBRENUKRDW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|