C10H12N4O — CID 12867814
4-amino-5-ethyl-2-phenyl-1,2,4-triazol-3-one (PubChem CID 12867814) has the molecular formula C10H12N4O and a molecular weight of 204.23 g/mol. Its IUPAC name is 4-amino-5-ethyl-2-phenyl-1,2,4-triazol-3-one.
| Compound Name | 4-amino-5-ethyl-2-phenyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 12867814 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 4-amino-5-ethyl-2-phenyl-1,2,4-triazol-3-one |
| SMILES | CCc1nn(-c2ccccc2)c(=O)n1N |
| InChI | InChI=1S/C10H12N4O/c1-2-9-12-14(10(15)13(9)11)8-6-4-3-5-7-8/h3-7H,2,11H2,1H3 |
| InChIKey | FGQGIVWRZBFHDX-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 65.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |