C13H16N4O2 — CID 132596066
N,N-diethyl-5-oxo-1-phenyl-1,2,4-triazole-4-carboxamide (PubChem CID 132596066) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is N,N-diethyl-5-oxo-1-phenyl-1,2,4-triazole-4-carboxamide.
| Compound Name | N,N-diethyl-5-oxo-1-phenyl-1,2,4-triazole-4-carboxamide |
|---|---|
| PubChem CID | 132596066 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | N,N-diethyl-5-oxo-1-phenyl-1,2,4-triazole-4-carboxamide |
| SMILES | CCN(CC)C(=O)n1cnn(-c2ccccc2)c1=O |
| InChI | InChI=1S/C13H16N4O2/c1-3-15(4-2)12(18)16-10-14-17(13(16)19)11-8-6-5-7-9-11/h5-10H,3-4H2,1-2H3 |
| InChIKey | XEZLNQXVHQYAHZ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 60.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |