C10H11N3O — CID 155061620
2-ethyl-4-phenyl-1,2,4-triazol-3-one (PubChem CID 155061620) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is 2-ethyl-4-phenyl-1,2,4-triazol-3-one.
| Compound Name | 2-ethyl-4-phenyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 155061620 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 2-ethyl-4-phenyl-1,2,4-triazol-3-one |
| SMILES | CCn1ncn(-c2ccccc2)c1=O |
| InChI | InChI=1S/C10H11N3O/c1-2-13-10(14)12(8-11-13)9-6-4-3-5-7-9/h3-8H,2H2,1H3 |
| InChIKey | LJGOBPXMCVVCBZ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |