C15H13N3S — CID 58997881
4-methyl-1,5-diphenyl-1,2,4-triazol-4-ium-3-thiolate (PubChem CID 58997881) has the molecular formula C15H13N3S and a molecular weight of 267.36 g/mol. Its IUPAC name is 4-methyl-1,5-diphenyl-1,2,4-triazol-4-ium-3-thiolate.
| Compound Name | 4-methyl-1,5-diphenyl-1,2,4-triazol-4-ium-3-thiolate |
|---|---|
| PubChem CID | 58997881 |
| Molecular Formula | C15H13N3S |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 4-methyl-1,5-diphenyl-1,2,4-triazol-4-ium-3-thiolate |
| SMILES | C[n+]1c([S-])nn(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C15H13N3S/c1-17-14(12-8-4-2-5-9-12)18(16-15(17)19)13-10-6-3-7-11-13/h2-11H,1H3 |
| InChIKey | NGGVRDYXVVDPTO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|