C43H38Cl2N6O8+2 — CID 126959207
4-(4-methylphenyl)-3-[[4-(4-methylphenyl)-1,5-diphenyl-1,2,4-triazol-4-ium-3-yl]methyl]-1,5-diphenyl-1,2,4-triazol-4-ium;perchloric acid (PubChem CID 126959207) has the molecular formula C43H38Cl2N6O8+2 and a molecular weight of 837.72 g/mol. Its IUPAC name is 4-(4-methylphenyl)-3-[[4-(4-methylphenyl)-1,5-diphenyl-1,2,4-triazol-4-ium-3-yl]methyl]-1,5-diphenyl-1,2,4-triazol-4-ium;perchloric acid.
| Compound Name | 4-(4-methylphenyl)-3-[[4-(4-methylphenyl)-1,5-diphenyl-1,2,4-triazol-4-ium-3-yl]methyl]-1,5-diphenyl-1,2,4-triazol-4-ium;perchloric acid |
|---|---|
| PubChem CID | 126959207 |
| Molecular Formula | C43H38Cl2N6O8+2 |
| Molecular Weight | 837.72 g/mol |
| Exact Mass | 836.21 |
| IUPAC Name | 4-(4-methylphenyl)-3-[[4-(4-methylphenyl)-1,5-diphenyl-1,2,4-triazol-4-ium-3-yl]methyl]-1,5-diphenyl-1,2,4-triazol-4-ium;perchloric acid |
| SMILES | Cc1ccc(-[n+]2c(Cc3nn(-c4ccccc4)c(-c4ccccc4)[n+]3-c3ccc(C)cc3)nn(-c3ccccc3)c2-c2ccccc2)cc1.[O-][Cl+3]([O-])([O-])O.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C43H36N6.2ClHO4/c1-32-23-27-36(28-24-32)46-40(44-48(38-19-11-5-12-20-38)42(46)34-15-7-3-8-16-34)31-41-45-49(39-21-13-6-14-22-39)43(35-17-9-4-10-18-35)47(41)37-29-25-33(2)26-30-37;2*2-1(3,4)5/h3-30H,31H2,1-2H3;2*(H,2,3,4,5)/q+2;; |
| InChIKey | KHSLMFQDBXEBGH-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 222.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.72 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|