C23H18N2O2 — CID 42726766
(1,3-diphenylpyrazol-5-yl) 4-methylbenzoate (PubChem CID 42726766) has the molecular formula C23H18N2O2 and a molecular weight of 354.41 g/mol. Its IUPAC name is (1,3-diphenylpyrazol-5-yl) 4-methylbenzoate.
| Compound Name | (1,3-diphenylpyrazol-5-yl) 4-methylbenzoate |
|---|---|
| PubChem CID | 42726766 |
| Molecular Formula | C23H18N2O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | (1,3-diphenylpyrazol-5-yl) 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2cc(-c3ccccc3)nn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H18N2O2/c1-17-12-14-19(15-13-17)23(26)27-22-16-21(18-8-4-2-5-9-18)24-25(22)20-10-6-3-7-11-20/h2-16H,1H3 |
| InChIKey | AVYPMCNPJBEPSG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |