About [1-(4-methoxyphenyl)-3-phenylpyrazol-5-yl] 3-methoxybenzoate
[1-(4-methoxyphenyl)-3-phenylpyrazol-5-yl] 3-methoxybenzoate (PubChem CID 1061733) has the molecular formula C24H20N2O4
and a molecular weight of 400.43 g/mol. Its IUPAC name is [1-(4-methoxyphenyl)-3-phenylpyrazol-5-yl] 3-methoxybenzoate.
Molecular Properties
| Compound Name | [1-(4-methoxyphenyl)-3-phenylpyrazol-5-yl] 3-methoxybenzoate |
| PubChem CID | 1061733 |
| Molecular Formula | C24H20N2O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | [1-(4-methoxyphenyl)-3-phenylpyrazol-5-yl] 3-methoxybenzoate |
| SMILES | COc1ccc(-n2nc(-c3ccccc3)cc2OC(=O)c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C24H20N2O4/c1-28-20-13-11-19(12-14-20)26-23(16-22(25-26)17-7-4-3-5-8-17)30-24(27)18-9-6-10-21(15-18)29-2/h3-16H,1-2H3 |
| InChIKey | IKQKLJKWKLGWKF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-(4-methoxyphenyl)-3-phenylpyrazol-5-yl] 3-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-methoxyphenyl)-3-phenylpyrazol-5-yl] 3-methoxybenzoate?
The IUPAC name of [1-(4-methoxyphenyl)-3-phenylpyrazol-5-yl] 3-methoxybenzoate (CID 1061733) is [1-(4-methoxyphenyl)-3-phenylpyrazol-5-yl] 3-methoxybenzoate.
What is the SMILES notation for [1-(4-methoxyphenyl)-3-phenylpyrazol-5-yl] 3-methoxybenzoate?
The canonical SMILES for [1-(4-methoxyphenyl)-3-phenylpyrazol-5-yl] 3-methoxybenzoate is COc1ccc(-n2nc(-c3ccccc3)cc2OC(=O)c2cccc(OC)c2)cc1.
What is the InChIKey of [1-(4-methoxyphenyl)-3-phenylpyrazol-5-yl] 3-methoxybenzoate?
The InChIKey is IKQKLJKWKLGWKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20N2O4/c1-28-20-13-11-19(12-14-20)26-23(16-22(25-26)17-7-4-3-5-8-17)30-24(27)18-9-6-10-21(15-18)29-2/h3-16H,1-2H3.
What are the key properties of [1-(4-methoxyphenyl)-3-phenylpyrazol-5-yl] 3-methoxybenzoate?
[1-(4-methoxyphenyl)-3-phenylpyrazol-5-yl] 3-methoxybenzoate has a molecular weight of 400.43 g/mol, XLogP of 4.78, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-methoxyphenyl)-3-phenylpyrazol-5-yl] 3-methoxybenzoate is sourced from PubChem (CID 1061733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).