C19H25N3O — CID 91466703
(1,5-diphenyl-1,2,4-triazol-3-yl)methanol;ethane (PubChem CID 91466703) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is (1,5-diphenyl-1,2,4-triazol-3-yl)methanol;ethane.
| Compound Name | (1,5-diphenyl-1,2,4-triazol-3-yl)methanol;ethane |
|---|---|
| PubChem CID | 91466703 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | (1,5-diphenyl-1,2,4-triazol-3-yl)methanol;ethane |
| SMILES | CC.CC.OCc1nc(-c2ccccc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H13N3O.2C2H6/c19-11-14-16-15(12-7-3-1-4-8-12)18(17-14)13-9-5-2-6-10-13;2*1-2/h1-10,19H,11H2;2*1-2H3 |
| InChIKey | BVZOVFCCMKPOBO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |