C18H17F3N4O4S — CID 44887853
N,4-dimethyl-1,5-diphenyl-1,2,4-triazol-4-ium-3-carboxamide;trifluoromethanesulfonate (PubChem CID 44887853) has the molecular formula C18H17F3N4O4S and a molecular weight of 442.42 g/mol. Its IUPAC name is N,4-dimethyl-1,5-diphenyl-1,2,4-triazol-4-ium-3-carboxamide;trifluoromethanesulfonate.
| Compound Name | N,4-dimethyl-1,5-diphenyl-1,2,4-triazol-4-ium-3-carboxamide;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 44887853 |
| Molecular Formula | C18H17F3N4O4S |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | N,4-dimethyl-1,5-diphenyl-1,2,4-triazol-4-ium-3-carboxamide;trifluoromethanesulfonate |
| SMILES | CNC(=O)c1nn(-c2ccccc2)c(-c2ccccc2)[n+]1C.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C17H16N4O.CHF3O3S/c1-18-16(22)15-19-21(14-11-7-4-8-12-14)17(20(15)2)13-9-5-3-6-10-13;2-1(3,4)8(5,6)7/h3-12H,1-2H3;(H,5,6,7) |
| InChIKey | IHFUKUYDXTUVQI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|