C22H17FN4O — CID 4799414
N-(5-fluoro-2-methylphenyl)-1,5-diphenyl-1,2,4-triazole-3-carboxamide (PubChem CID 4799414) has the molecular formula C22H17FN4O and a molecular weight of 372.40 g/mol. Its IUPAC name is N-(5-fluoro-2-methylphenyl)-1,5-diphenyl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-(5-fluoro-2-methylphenyl)-1,5-diphenyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 4799414 |
| Molecular Formula | C22H17FN4O |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | N-(5-fluoro-2-methylphenyl)-1,5-diphenyl-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1ccc(F)cc1NC(=O)c1nc(-c2ccccc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H17FN4O/c1-15-12-13-17(23)14-19(15)24-22(28)20-25-21(16-8-4-2-5-9-16)27(26-20)18-10-6-3-7-11-18/h2-14H,1H3,(H,24,28) |
| InChIKey | PYZMEMIXIXADIF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |