C21H17N5O — CID 55363226
N-(4-methyl-2-pyridinyl)-1,5-diphenyl-1,2,4-triazole-3-carboxamide (PubChem CID 55363226) has the molecular formula C21H17N5O and a molecular weight of 355.40 g/mol. Its IUPAC name is N-(4-methyl-2-pyridinyl)-1,5-diphenyl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-(4-methyl-2-pyridinyl)-1,5-diphenyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 55363226 |
| Molecular Formula | C21H17N5O |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | N-(4-methyl-2-pyridinyl)-1,5-diphenyl-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1ccnc(NC(=O)c2nc(-c3ccccc3)n(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C21H17N5O/c1-15-12-13-22-18(14-15)23-21(27)19-24-20(16-8-4-2-5-9-16)26(25-19)17-10-6-3-7-11-17/h2-14H,1H3,(H,22,23,27) |
| InChIKey | NKVRMXJYMQDKKZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |