C23H19N5O2 — CID 134953915
4-(5-benzamido-2-phenyl-1,2,4-triazol-3-yl)-N-methylbenzamide (PubChem CID 134953915) has the molecular formula C23H19N5O2 and a molecular weight of 397.44 g/mol. Its IUPAC name is 4-(5-benzamido-2-phenyl-1,2,4-triazol-3-yl)-N-methylbenzamide.
| Compound Name | 4-(5-benzamido-2-phenyl-1,2,4-triazol-3-yl)-N-methylbenzamide |
|---|---|
| PubChem CID | 134953915 |
| Molecular Formula | C23H19N5O2 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 4-(5-benzamido-2-phenyl-1,2,4-triazol-3-yl)-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(-c2nc(NC(=O)c3ccccc3)nn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H19N5O2/c1-24-21(29)18-14-12-16(13-15-18)20-25-23(26-22(30)17-8-4-2-5-9-17)27-28(20)19-10-6-3-7-11-19/h2-15H,1H3,(H,24,29)(H,26,27,30) |
| InChIKey | MEPFVNZOHNDCAN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |