C24H20N8O2 — CID 161012194
azanium [4-[[5-[(4-ethynylbenzoyl)amino]-2-phenyl-1,2,4-triazol-3-yl]carbamoyl]phenyl]iminoazanide (PubChem CID 161012194) has the molecular formula C24H20N8O2 and a molecular weight of 452.48 g/mol. Its IUPAC name is azanium [4-[[5-[(4-ethynylbenzoyl)amino]-2-phenyl-1,2,4-triazol-3-yl]carbamoyl]phenyl]iminoazanide.
| Compound Name | azanium [4-[[5-[(4-ethynylbenzoyl)amino]-2-phenyl-1,2,4-triazol-3-yl]carbamoyl]phenyl]iminoazanide |
|---|---|
| PubChem CID | 161012194 |
| Molecular Formula | C24H20N8O2 |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | azanium [4-[[5-[(4-ethynylbenzoyl)amino]-2-phenyl-1,2,4-triazol-3-yl]carbamoyl]phenyl]iminoazanide |
| SMILES | C#Cc1ccc(C(=O)Nc2nc(NC(=O)c3ccc(N=[N-])cc3)n(-c3ccccc3)n2)cc1.[NH4+] |
| InChI | InChI=1S/C24H16N7O2.H3N/c1-2-16-8-10-17(11-9-16)21(32)26-23-28-24(31(30-23)20-6-4-3-5-7-20)27-22(33)18-12-14-19(29-25)15-13-18;/h1,3-15H,(H2,26,27,28,30,32,33);1H3/q-1;/p+1 |
| InChIKey | LAOTXLQZJCIULW-UHFFFAOYSA-O |
| XLogP | 4.78 |
| TPSA | 160.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|