C31H34N6O2 — CID 159056238
4-[(heptanoylamino)methyl]-N-[2-phenyl-5-(1-phenylethenylamino)-1,2,4-triazol-3-yl]benzamide (PubChem CID 159056238) has the molecular formula C31H34N6O2 and a molecular weight of 522.65 g/mol. Its IUPAC name is 4-[(heptanoylamino)methyl]-N-[2-phenyl-5-(1-phenylethenylamino)-1,2,4-triazol-3-yl]benzamide.
| Compound Name | 4-[(heptanoylamino)methyl]-N-[2-phenyl-5-(1-phenylethenylamino)-1,2,4-triazol-3-yl]benzamide |
|---|---|
| PubChem CID | 159056238 |
| Molecular Formula | C31H34N6O2 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.27 |
| IUPAC Name | 4-[(heptanoylamino)methyl]-N-[2-phenyl-5-(1-phenylethenylamino)-1,2,4-triazol-3-yl]benzamide |
| SMILES | C=C(Nc1nc(NC(=O)c2ccc(CNC(=O)CCCCCC)cc2)n(-c2ccccc2)n1)c1ccccc1 |
| InChI | InChI=1S/C31H34N6O2/c1-3-4-5-12-17-28(38)32-22-24-18-20-26(21-19-24)29(39)34-31-35-30(33-23(2)25-13-8-6-9-14-25)36-37(31)27-15-10-7-11-16-27/h6-11,13-16,18-21H,2-5,12,17,22H2,1H3,(H,32,38)(H2,33,34,35,36,39) |
| InChIKey | JFCODXPDKQRARP-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|